C28H27NO3S2 — CID 135005315
(E)-2-[bis(benzylsulfanyl)methylidene]-5-[4-(dimethylamino)phenyl]-3-oxopent-4-enoic acid (PubChem CID 135005315) has the molecular formula C28H27NO3S2 and a molecular weight of 489.66 g/mol. Its IUPAC name is (E)-2-[bis(benzylsulfanyl)methylidene]-5-[4-(dimethylamino)phenyl]-3-oxopent-4-enoic acid.
| Compound Name | (E)-2-[bis(benzylsulfanyl)methylidene]-5-[4-(dimethylamino)phenyl]-3-oxopent-4-enoic acid |
|---|---|
| PubChem CID | 135005315 |
| Molecular Formula | C28H27NO3S2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | (E)-2-[bis(benzylsulfanyl)methylidene]-5-[4-(dimethylamino)phenyl]-3-oxopent-4-enoic acid |
| SMILES | CN(C)c1ccc(/C=C/C(=O)C(C(=O)O)=C(SCc2ccccc2)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H27NO3S2/c1-29(2)24-16-13-21(14-17-24)15-18-25(30)26(27(31)32)28(33-19-22-9-5-3-6-10-22)34-20-23-11-7-4-8-12-23/h3-18H,19-20H2,1-2H3,(H,31,32)/b18-15+ |
| InChIKey | LWZAVJZMSCYYRZ-OBGWFSINSA-N |
| XLogP | 6.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|