C26H24O2S2 — CID 3869424
1,1-bis(benzylsulfanyl)-5-(4-methoxyphenyl)penta-1,4-dien-3-one (PubChem CID 3869424) has the molecular formula C26H24O2S2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 1,1-bis(benzylsulfanyl)-5-(4-methoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | 1,1-bis(benzylsulfanyl)-5-(4-methoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 3869424 |
| Molecular Formula | C26H24O2S2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1,1-bis(benzylsulfanyl)-5-(4-methoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1ccc(C=CC(=O)C=C(SCc2ccccc2)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24O2S2/c1-28-25-16-13-21(14-17-25)12-15-24(27)18-26(29-19-22-8-4-2-5-9-22)30-20-23-10-6-3-7-11-23/h2-18H,19-20H2,1H3 |
| InChIKey | ZWPPRLMBSGPIAY-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|