C14H16O2S2 — CID 71326301
5-(4-methoxyphenyl)-1,1-bis(methylsulfanyl)penta-1,4-dien-3-one (PubChem CID 71326301) has the molecular formula C14H16O2S2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1,1-bis(methylsulfanyl)penta-1,4-dien-3-one.
| Compound Name | 5-(4-methoxyphenyl)-1,1-bis(methylsulfanyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 71326301 |
| Molecular Formula | C14H16O2S2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-(4-methoxyphenyl)-1,1-bis(methylsulfanyl)penta-1,4-dien-3-one |
| SMILES | COc1ccc(C=CC(=O)C=C(SC)SC)cc1 |
| InChI | InChI=1S/C14H16O2S2/c1-16-13-8-5-11(6-9-13)4-7-12(15)10-14(17-2)18-3/h4-10H,1-3H3 |
| InChIKey | DCNKDFPYHHCRQR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|