C13H12F3NO2 — CID 596513
5-amino-6,6,6-trifluoro-1-(4-methoxyphenyl)hexa-1,4-dien-3-one (PubChem CID 596513) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 5-amino-6,6,6-trifluoro-1-(4-methoxyphenyl)hexa-1,4-dien-3-one.
| Compound Name | 5-amino-6,6,6-trifluoro-1-(4-methoxyphenyl)hexa-1,4-dien-3-one |
|---|---|
| PubChem CID | 596513 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 5-amino-6,6,6-trifluoro-1-(4-methoxyphenyl)hexa-1,4-dien-3-one |
| SMILES | COc1ccc(C=CC(=O)C=C(N)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H12F3NO2/c1-19-11-6-3-9(4-7-11)2-5-10(18)8-12(17)13(14,15)16/h2-8H,17H2,1H3 |
| InChIKey | HZHGNTLLFNPLBZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|