C14H16O2 — CID 135073117
(3E,5E)-6-(4-methoxyphenyl)-4-methylhexa-3,5-dien-2-one (PubChem CID 135073117) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (3E,5E)-6-(4-methoxyphenyl)-4-methylhexa-3,5-dien-2-one.
| Compound Name | (3E,5E)-6-(4-methoxyphenyl)-4-methylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 135073117 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (3E,5E)-6-(4-methoxyphenyl)-4-methylhexa-3,5-dien-2-one |
| SMILES | COc1ccc(/C=C/C(C)=C/C(C)=O)cc1 |
| InChI | InChI=1S/C14H16O2/c1-11(10-12(2)15)4-5-13-6-8-14(16-3)9-7-13/h4-10H,1-3H3/b5-4+,11-10+ |
| InChIKey | FEDPSZGDLFZHBW-PMXBNEBOSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|