C42H40NiO8 — CID 10842631
bis((1E,4Z,6E)-5-hydroxy-1,7-bis(4-methoxyphenyl)hepta-1,4,6-trien-3-one);nickel (PubChem CID 10842631) has the molecular formula C42H40NiO8 and a molecular weight of 731.47 g/mol. Its IUPAC name is bis((1E,4Z,6E)-5-hydroxy-1,7-bis(4-methoxyphenyl)hepta-1,4,6-trien-3-one);nickel.
| Compound Name | bis((1E,4Z,6E)-5-hydroxy-1,7-bis(4-methoxyphenyl)hepta-1,4,6-trien-3-one);nickel |
|---|---|
| PubChem CID | 10842631 |
| Molecular Formula | C42H40NiO8 |
| Molecular Weight | 731.47 g/mol |
| Exact Mass | 730.21 |
| IUPAC Name | bis((1E,4Z,6E)-5-hydroxy-1,7-bis(4-methoxyphenyl)hepta-1,4,6-trien-3-one);nickel |
| SMILES | COc1ccc(/C=C/C(=O)/C=C(O)/C=C/c2ccc(OC)cc2)cc1.COc1ccc(/C=C/C(=O)/C=C(O)/C=C/c2ccc(OC)cc2)cc1.[Ni] |
| InChI | InChI=1S/2C21H20O4.Ni/c2*1-24-20-11-5-16(6-12-20)3-9-18(22)15-19(23)10-4-17-7-13-21(25-2)14-8-17;/h2*3-15,22H,1-2H3;/b2*9-3+,10-4+,18-15-; |
| InChIKey | LMXRSFMJZHXKDR-UVGVFCCKSA-N |
| XLogP | 8.88 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.47 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|