C27H24O4 — CID 127027135
(1E,4Z,6E)-5-hydroxy-7-(4-methoxyphenyl)-1-(4-phenylmethoxyphenyl)hepta-1,4,6-trien-3-one (PubChem CID 127027135) has the molecular formula C27H24O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is (1E,4Z,6E)-5-hydroxy-7-(4-methoxyphenyl)-1-(4-phenylmethoxyphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-5-hydroxy-7-(4-methoxyphenyl)-1-(4-phenylmethoxyphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 127027135 |
| Molecular Formula | C27H24O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (1E,4Z,6E)-5-hydroxy-7-(4-methoxyphenyl)-1-(4-phenylmethoxyphenyl)hepta-1,4,6-trien-3-one |
| SMILES | COc1ccc(/C=C/C(O)=C/C(=O)/C=C/c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H24O4/c1-30-26-15-9-21(10-16-26)7-13-24(28)19-25(29)14-8-22-11-17-27(18-12-22)31-20-23-5-3-2-4-6-23/h2-19,28H,20H2,1H3/b13-7+,14-8+,24-19- |
| InChIKey | KMJWBLMXJLLJQG-NNLKEFMESA-N |
| XLogP | 6.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|