C39H38N2O — CID 15868831
bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-phenylmethanol (PubChem CID 15868831) has the molecular formula C39H38N2O and a molecular weight of 550.75 g/mol. Its IUPAC name is bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-phenylmethanol.
| Compound Name | bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-phenylmethanol |
|---|---|
| PubChem CID | 15868831 |
| Molecular Formula | C39H38N2O |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-phenylmethanol |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(C(O)(c3ccccc3)c3ccc(/C=C/c4ccc(N(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H38N2O/c1-40(2)37-26-18-32(19-27-37)12-10-30-14-22-35(23-15-30)39(42,34-8-6-5-7-9-34)36-24-16-31(17-25-36)11-13-33-20-28-38(29-21-33)41(3)4/h5-29,42H,1-4H3/b12-10+,13-11+ |
| InChIKey | CZXKSGUFAIEGIF-DCIPZJNNSA-N |
| XLogP | 8.44 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|