C27H29ClN2O4 — CID 74895298
[4-[5-[4-(dimethylamino)phenyl]-3-phenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate (PubChem CID 74895298) has the molecular formula C27H29ClN2O4 and a molecular weight of 480.99 g/mol. Its IUPAC name is [4-[5-[4-(dimethylamino)phenyl]-3-phenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate.
| Compound Name | [4-[5-[4-(dimethylamino)phenyl]-3-phenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
|---|---|
| PubChem CID | 74895298 |
| Molecular Formula | C27H29ClN2O4 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | [4-[5-[4-(dimethylamino)phenyl]-3-phenylpenta-2,4-dienylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
| SMILES | CN(C)c1ccc(C=CC(=CC=C2C=CC(=[N+](C)C)C=C2)c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C27H29N2.ClHO4/c1-28(2)26-18-12-22(13-19-26)10-16-25(24-8-6-5-7-9-24)17-11-23-14-20-27(21-15-23)29(3)4;2-1(3,4)5/h5-21H,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | RFBZOINUOGOJHB-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|