C33H32N2O — CID 66673921
1,5-bis[4-(dimethylamino)phenyl]-2,4-diphenylpenta-1,4-dien-3-one (PubChem CID 66673921) has the molecular formula C33H32N2O and a molecular weight of 472.63 g/mol. Its IUPAC name is 1,5-bis[4-(dimethylamino)phenyl]-2,4-diphenylpenta-1,4-dien-3-one.
| Compound Name | 1,5-bis[4-(dimethylamino)phenyl]-2,4-diphenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 66673921 |
| Molecular Formula | C33H32N2O |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 1,5-bis[4-(dimethylamino)phenyl]-2,4-diphenylpenta-1,4-dien-3-one |
| SMILES | CN(C)c1ccc(C=C(C(=O)C(=Cc2ccc(N(C)C)cc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H32N2O/c1-34(2)29-19-15-25(16-20-29)23-31(27-11-7-5-8-12-27)33(36)32(28-13-9-6-10-14-28)24-26-17-21-30(22-18-26)35(3)4/h5-24H,1-4H3 |
| InChIKey | PEPPWTSJNYVLAU-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|