C29H24N2O — CID 141027031
2,4-bis(4-aminophenyl)-1,5-diphenylpenta-1,4-dien-3-one (PubChem CID 141027031) has the molecular formula C29H24N2O and a molecular weight of 416.52 g/mol. Its IUPAC name is 2,4-bis(4-aminophenyl)-1,5-diphenylpenta-1,4-dien-3-one.
| Compound Name | 2,4-bis(4-aminophenyl)-1,5-diphenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 141027031 |
| Molecular Formula | C29H24N2O |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2,4-bis(4-aminophenyl)-1,5-diphenylpenta-1,4-dien-3-one |
| SMILES | Nc1ccc(C(=Cc2ccccc2)C(=O)C(=Cc2ccccc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C29H24N2O/c30-25-15-11-23(12-16-25)27(19-21-7-3-1-4-8-21)29(32)28(20-22-9-5-2-6-10-22)24-13-17-26(31)18-14-24/h1-20H,30-31H2 |
| InChIKey | MTUJTUOYAWETTQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|