C21H27N2+ — CID 20709076
[4-[(E)-4-[4-(dimethylamino)phenyl]pent-3-en-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 20709076) has the molecular formula C21H27N2+ and a molecular weight of 307.46 g/mol. Its IUPAC name is [4-[(E)-4-[4-(dimethylamino)phenyl]pent-3-en-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[(E)-4-[4-(dimethylamino)phenyl]pent-3-en-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 20709076 |
| Molecular Formula | C21H27N2+ |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | [4-[(E)-4-[4-(dimethylamino)phenyl]pent-3-en-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CC(/C=C(\C)c1ccc(N(C)C)cc1)=C1C=CC(=[N+](C)C)C=C1 |
| InChI | InChI=1S/C21H27N2/c1-16(18-7-11-20(12-8-18)22(3)4)15-17(2)19-9-13-21(14-10-19)23(5)6/h7-15H,1-6H3/q+1 |
| InChIKey | WOXLRXQSXKXCRK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|