C22H24ClN3 — CID 18457887
[4-[[4-(dimethylamino)phenyl]-pyridin-2-ylmethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride (PubChem CID 18457887) has the molecular formula C22H24ClN3 and a molecular weight of 365.91 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)phenyl]-pyridin-2-ylmethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride.
| Compound Name | [4-[[4-(dimethylamino)phenyl]-pyridin-2-ylmethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 18457887 |
| Molecular Formula | C22H24ClN3 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | [4-[[4-(dimethylamino)phenyl]-pyridin-2-ylmethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccccn2)cc1.[Cl-] |
| InChI | InChI=1S/C22H24N3.ClH/c1-24(2)19-12-8-17(9-13-19)22(21-7-5-6-16-23-21)18-10-14-20(15-11-18)25(3)4;/h5-16H,1-4H3;1H/q+1;/p-1 |
| InChIKey | VSZJUUQXHBDLDN-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 19.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|