C24H24F3N2+ — CID 102089262
[4-[[4-(dimethylamino)phenyl]-[2-(trifluoromethyl)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 102089262) has the molecular formula C24H24F3N2+ and a molecular weight of 397.46 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)phenyl]-[2-(trifluoromethyl)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[[4-(dimethylamino)phenyl]-[2-(trifluoromethyl)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 102089262 |
| Molecular Formula | C24H24F3N2+ |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [4-[[4-(dimethylamino)phenyl]-[2-(trifluoromethyl)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24F3N2/c1-28(2)19-13-9-17(10-14-19)23(18-11-15-20(16-12-18)29(3)4)21-7-5-6-8-22(21)24(25,26)27/h5-16H,1-4H3/q+1 |
| InChIKey | WWARPORCSUXDQS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|