C24H25N4S+ — CID 69131178
[4-[[4-(dimethylamino)phenyl]-(7-methyl-2,1,3-benzothiadiazol-4-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 69131178) has the molecular formula C24H25N4S+ and a molecular weight of 401.56 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)phenyl]-(7-methyl-2,1,3-benzothiadiazol-4-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[[4-(dimethylamino)phenyl]-(7-methyl-2,1,3-benzothiadiazol-4-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 69131178 |
| Molecular Formula | C24H25N4S+ |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [4-[[4-(dimethylamino)phenyl]-(7-methyl-2,1,3-benzothiadiazol-4-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | Cc1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(C)C)cc2)c2nsnc12 |
| InChI | InChI=1S/C24H25N4S/c1-16-6-15-21(24-23(16)25-29-26-24)22(17-7-11-19(12-8-17)27(2)3)18-9-13-20(14-10-18)28(4)5/h6-15H,1-5H3/q+1 |
| InChIKey | KZQDKYRJKRFBQA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 32.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|