C33H31N2+ — CID 101255429
[4-[[4-(dimethylamino)phenyl]-(8-phenylnaphthalen-1-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 101255429) has the molecular formula C33H31N2+ and a molecular weight of 455.63 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)phenyl]-(8-phenylnaphthalen-1-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[[4-(dimethylamino)phenyl]-(8-phenylnaphthalen-1-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 101255429 |
| Molecular Formula | C33H31N2+ |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | [4-[[4-(dimethylamino)phenyl]-(8-phenylnaphthalen-1-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2cccc3cccc(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C33H31N2/c1-34(2)28-20-16-26(17-21-28)32(27-18-22-29(23-19-27)35(3)4)31-15-9-13-25-12-8-14-30(33(25)31)24-10-6-5-7-11-24/h5-23H,1-4H3/q+1 |
| InChIKey | LNVIJFRCZKFORH-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|