C23H27N3 — CID 90472468
4-[[4,4-bis(aminomethyl)cyclohexa-2,5-dien-1-ylidene]-phenylmethyl]-N,N-dimethylaniline (PubChem CID 90472468) has the molecular formula C23H27N3 and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-[[4,4-bis(aminomethyl)cyclohexa-2,5-dien-1-ylidene]-phenylmethyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4,4-bis(aminomethyl)cyclohexa-2,5-dien-1-ylidene]-phenylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 90472468 |
| Molecular Formula | C23H27N3 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 4-[[4,4-bis(aminomethyl)cyclohexa-2,5-dien-1-ylidene]-phenylmethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(=C2C=CC(CN)(CN)C=C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27N3/c1-26(2)21-10-8-19(9-11-21)22(18-6-4-3-5-7-18)20-12-14-23(16-24,17-25)15-13-20/h3-15H,16-17,24-25H2,1-2H3 |
| InChIKey | PSCXSRSRDCPWEW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|