C33H40N6O6S2 — CID 56842951
[4-[(4-anilinonaphthalen-1-yl)-[4-(dimethylamino)phenyl]methylidene]-1-(azaniumylmethyl)cyclohexa-2,5-dien-1-yl]methylazanium disulfamate (PubChem CID 56842951) has the molecular formula C33H40N6O6S2 and a molecular weight of 680.85 g/mol. Its IUPAC name is [4-[(4-anilinonaphthalen-1-yl)-[4-(dimethylamino)phenyl]methylidene]-1-(azaniumylmethyl)cyclohexa-2,5-dien-1-yl]methylazanium disulfamate.
| Compound Name | [4-[(4-anilinonaphthalen-1-yl)-[4-(dimethylamino)phenyl]methylidene]-1-(azaniumylmethyl)cyclohexa-2,5-dien-1-yl]methylazanium disulfamate |
|---|---|
| PubChem CID | 56842951 |
| Molecular Formula | C33H40N6O6S2 |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.25 |
| IUPAC Name | [4-[(4-anilinonaphthalen-1-yl)-[4-(dimethylamino)phenyl]methylidene]-1-(azaniumylmethyl)cyclohexa-2,5-dien-1-yl]methylazanium disulfamate |
| SMILES | CN(C)c1ccc(C(=C2C=CC(C[NH3+])(C[NH3+])C=C2)c2ccc(Nc3ccccc3)c3ccccc23)cc1.NS(=O)(=O)[O-].NS(=O)(=O)[O-] |
| InChI | InChI=1S/C33H34N4.2H3NO3S/c1-37(2)27-14-12-24(13-15-27)32(25-18-20-33(22-34,23-35)21-19-25)30-16-17-31(29-11-7-6-10-28(29)30)36-26-8-4-3-5-9-26;2*1-5(2,3)4/h3-21,36H,22-23,34-35H2,1-2H3;2*(H3,1,2,3,4) |
| InChIKey | AQOJNTUCAVJMEB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 236.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|