C27H29N3O6S2 — CID 98051674
4-[[4,4-bis(aminomethyl)cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]naphthalene-2,7-disulfonic acid (PubChem CID 98051674) has the molecular formula C27H29N3O6S2 and a molecular weight of 555.68 g/mol. Its IUPAC name is 4-[[4,4-bis(aminomethyl)cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-[[4,4-bis(aminomethyl)cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 98051674 |
| Molecular Formula | C27H29N3O6S2 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 4-[[4,4-bis(aminomethyl)cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]naphthalene-2,7-disulfonic acid |
| SMILES | CN(C)c1ccc(C(=C2C=CC(CN)(CN)C=C2)c2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc23)cc1 |
| InChI | InChI=1S/C27H29N3O6S2/c1-30(2)21-5-3-18(4-6-21)26(19-9-11-27(16-28,17-29)12-10-19)25-15-23(38(34,35)36)14-20-13-22(37(31,32)33)7-8-24(20)25/h3-15H,16-17,28-29H2,1-2H3,(H,31,32,33)(H,34,35,36) |
| InChIKey | NCKPAMDZGLGCEP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 164.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|