C27H37N4O6S2+ — CID 170846835
2-[1-(1,2-diaminoethyl)-4-[[4-(diethylamino)phenyl]-(2,4-disulfophenyl)methylidene]cyclohexa-2,5-dien-1-yl]ethylazanium (PubChem CID 170846835) has the molecular formula C27H37N4O6S2+ and a molecular weight of 577.75 g/mol. Its IUPAC name is 2-[1-(1,2-diaminoethyl)-4-[[4-(diethylamino)phenyl]-(2,4-disulfophenyl)methylidene]cyclohexa-2,5-dien-1-yl]ethylazanium.
| Compound Name | 2-[1-(1,2-diaminoethyl)-4-[[4-(diethylamino)phenyl]-(2,4-disulfophenyl)methylidene]cyclohexa-2,5-dien-1-yl]ethylazanium |
|---|---|
| PubChem CID | 170846835 |
| Molecular Formula | C27H37N4O6S2+ |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 2-[1-(1,2-diaminoethyl)-4-[[4-(diethylamino)phenyl]-(2,4-disulfophenyl)methylidene]cyclohexa-2,5-dien-1-yl]ethylazanium |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(CC[NH3+])(C(N)CN)C=C2)c2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C27H36N4O6S2/c1-3-31(4-2)21-7-5-19(6-8-21)26(20-11-13-27(14-12-20,15-16-28)25(30)18-29)23-10-9-22(38(32,33)34)17-24(23)39(35,36)37/h5-14,17,25H,3-4,15-16,18,28-30H2,1-2H3,(H,32,33,34)(H,35,36,37)/p+1/b26-20- |
| InChIKey | XGTFVUZGZBLOBE-QOMWVZHYSA-O |
| XLogP | 1.86 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|