About CID 131875715
CID 131875715 (PubChem CID 131875715) has the molecular formula C27H32N2NaO7S2
and a molecular weight of 583.68 g/mol.
Molecular Properties
| Compound Name | CID 131875715 |
| PubChem CID | 131875715 |
| Molecular Formula | C27H32N2NaO7S2 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | — |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2cc(O)c(S(=O)(=O)O)cc2S(=O)(=O)[O-])cc1.[Na] |
| InChI | InChI=1S/C27H32N2O7S2.Na/c1-5-28(6-2)21-13-9-19(10-14-21)27(20-11-15-22(16-12-20)29(7-3)8-4)23-17-24(30)26(38(34,35)36)18-25(23)37(31,32)33;/h9-18H,5-8H2,1-4H3,(H2-,30,31,32,33,34,35,36); |
| InChIKey | VRJACOWSWUNNIL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 131875715 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131875715?
The IUPAC name of CID 131875715 (CID 131875715) is not available.
What is the SMILES notation for CID 131875715?
The canonical SMILES for CID 131875715 is CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2cc(O)c(S(=O)(=O)O)cc2S(=O)(=O)[O-])cc1.[Na].
What is the InChIKey of CID 131875715?
The InChIKey is VRJACOWSWUNNIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32N2O7S2.Na/c1-5-28(6-2)21-13-9-19(10-14-21)27(20-11-15-22(16-12-20)29(7-3)8-4)23-17-24(30)26(38(34,35)36)18-25(23)37(31,32)33;/h9-18H,5-8H2,1-4H3,(H2-,30,31,32,33,34,35,36);.
What are the key properties of CID 131875715?
CID 131875715 has a molecular weight of 583.68 g/mol, XLogP of 3.43, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131875715 is sourced from PubChem (CID 131875715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).