C27H34N3O6S2+ — CID 177475586
5-azaniumyloxysulfonyl-2-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate (PubChem CID 177475586) has the molecular formula C27H34N3O6S2+ and a molecular weight of 560.72 g/mol. Its IUPAC name is 5-azaniumyloxysulfonyl-2-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate.
| Compound Name | 5-azaniumyloxysulfonyl-2-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
|---|---|
| PubChem CID | 177475586 |
| Molecular Formula | C27H34N3O6S2+ |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 5-azaniumyloxysulfonyl-2-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2ccc(S(=O)(=O)O[NH3+])cc2S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C27H34N3O6S2/c1-5-29(6-2)22-13-9-20(10-14-22)27(21-11-15-23(16-12-21)30(7-3)8-4)25-18-17-24(38(34,35)36-28)19-26(25)37(31,32)33/h9-19H,5-8H2,1-4,28H3/q+1 |
| InChIKey | OKDMITVPBUSACB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|