C43H50N3O3S+ — CID 58253051
[4-[[4-(diethylamino)-2-methylphenyl]-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-methylphenyl)methyl]azanium (PubChem CID 58253051) has the molecular formula C43H50N3O3S+ and a molecular weight of 688.96 g/mol. Its IUPAC name is [4-[[4-(diethylamino)-2-methylphenyl]-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-methylphenyl)methyl]azanium.
| Compound Name | [4-[[4-(diethylamino)-2-methylphenyl]-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 58253051 |
| Molecular Formula | C43H50N3O3S+ |
| Molecular Weight | 688.96 g/mol |
| Exact Mass | 688.36 |
| IUPAC Name | [4-[[4-(diethylamino)-2-methylphenyl]-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-methylphenyl)methyl]azanium |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)Cc3cccc(C)c3)C=C2)c2ccc(N(CC)Cc3cccc(S(=O)(=O)O)c3)cc2)c(C)c1 |
| InChI | InChI=1S/C43H49N3O3S/c1-7-44(8-2)40-25-26-42(33(6)28-40)43(36-17-21-38(22-18-36)45(9-3)30-34-14-11-13-32(5)27-34)37-19-23-39(24-20-37)46(10-4)31-35-15-12-16-41(29-35)50(47,48)49/h11-29H,7-10,30-31H2,1-6H3/p+1 |
| InChIKey | WVVMBQPQSHWNDV-UHFFFAOYSA-O |
| XLogP | 9.02 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.96 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|