C38H39N2O6S2+ — CID 59931742
ethyl-[4-[[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]-(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[(3-sulfophenyl)methyl]azanium (PubChem CID 59931742) has the molecular formula C38H39N2O6S2+ and a molecular weight of 683.87 g/mol. Its IUPAC name is ethyl-[4-[[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]-(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[(3-sulfophenyl)methyl]azanium.
| Compound Name | ethyl-[4-[[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]-(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[(3-sulfophenyl)methyl]azanium |
|---|---|
| PubChem CID | 59931742 |
| Molecular Formula | C38H39N2O6S2+ |
| Molecular Weight | 683.87 g/mol |
| Exact Mass | 683.22 |
| IUPAC Name | ethyl-[4-[[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]-(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[(3-sulfophenyl)methyl]azanium |
| SMILES | CCN(Cc1cccc(S(=O)(=O)O)c1)c1ccc(C(=C2C=CC(=[N+](CC)Cc3cccc(S(=O)(=O)O)c3)C=C2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C38H38N2O6S2/c1-4-39(26-29-8-6-10-36(24-29)47(41,42)43)34-20-16-32(17-21-34)38(31-14-12-28(3)13-15-31)33-18-22-35(23-19-33)40(5-2)27-30-9-7-11-37(25-30)48(44,45)46/h6-25H,4-5,26-27H2,1-3H3,(H-,41,42,43,44,45,46)/p+1 |
| InChIKey | YRFJLMFAHYUJRX-UHFFFAOYSA-O |
| XLogP | 7.12 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.87 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|