C45H46N3O4S+ — CID 140792631
[4-[[4-[benzyl(ethyl)amino]phenyl]-[4-(4-ethoxyanilino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-sulfophenyl)methyl]azanium (PubChem CID 140792631) has the molecular formula C45H46N3O4S+ and a molecular weight of 724.95 g/mol. Its IUPAC name is [4-[[4-[benzyl(ethyl)amino]phenyl]-[4-(4-ethoxyanilino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-sulfophenyl)methyl]azanium.
| Compound Name | [4-[[4-[benzyl(ethyl)amino]phenyl]-[4-(4-ethoxyanilino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-sulfophenyl)methyl]azanium |
|---|---|
| PubChem CID | 140792631 |
| Molecular Formula | C45H46N3O4S+ |
| Molecular Weight | 724.95 g/mol |
| Exact Mass | 724.32 |
| IUPAC Name | [4-[[4-[benzyl(ethyl)amino]phenyl]-[4-(4-ethoxyanilino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-sulfophenyl)methyl]azanium |
| SMILES | CCOc1ccc(Nc2ccc(C(=C3C=CC(=[N+](CC)Cc4cccc(S(=O)(=O)O)c4)C=C3)c3ccc(N(CC)Cc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C45H45N3O4S/c1-4-47(32-34-11-8-7-9-12-34)41-25-17-37(18-26-41)45(36-15-21-39(22-16-36)46-40-23-29-43(30-24-40)52-6-3)38-19-27-42(28-20-38)48(5-2)33-35-13-10-14-44(31-35)53(49,50)51/h7-31H,4-6,32-33H2,1-3H3,(H,49,50,51)/p+1 |
| InChIKey | RAFAVBKWHRLMEI-UHFFFAOYSA-O |
| XLogP | 9.70 |
| TPSA | 81.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.95 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|