C37H35Cl2N2O3S+ — CID 162019847
[4-[[4-[benzyl(ethyl)amino]phenyl]-(2,6-dichlorophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-sulfophenyl)methyl]azanium (PubChem CID 162019847) has the molecular formula C37H35Cl2N2O3S+ and a molecular weight of 658.67 g/mol. Its IUPAC name is [4-[[4-[benzyl(ethyl)amino]phenyl]-(2,6-dichlorophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-sulfophenyl)methyl]azanium.
| Compound Name | [4-[[4-[benzyl(ethyl)amino]phenyl]-(2,6-dichlorophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-sulfophenyl)methyl]azanium |
|---|---|
| PubChem CID | 162019847 |
| Molecular Formula | C37H35Cl2N2O3S+ |
| Molecular Weight | 658.67 g/mol |
| Exact Mass | 657.17 |
| IUPAC Name | [4-[[4-[benzyl(ethyl)amino]phenyl]-(2,6-dichlorophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-sulfophenyl)methyl]azanium |
| SMILES | CCN(Cc1ccccc1)c1ccc(C(=C2C=CC(=[N+](CC)Cc3cccc(S(=O)(=O)O)c3)C=C2)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C37H34Cl2N2O3S/c1-3-40(25-27-10-6-5-7-11-27)31-20-16-29(17-21-31)36(37-34(38)14-9-15-35(37)39)30-18-22-32(23-19-30)41(4-2)26-28-12-8-13-33(24-28)45(42,43)44/h5-24H,3-4,25-26H2,1-2H3/p+1 |
| InChIKey | PPYBKIYWCWFANW-UHFFFAOYSA-O |
| XLogP | 8.87 |
| TPSA | 60.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.67 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|