C28H27NO7S2 — CID 175844711
2-[cyclohexa-2,5-dien-1-ylidene-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfonic acid (PubChem CID 175844711) has the molecular formula C28H27NO7S2 and a molecular weight of 553.66 g/mol. Its IUPAC name is 2-[cyclohexa-2,5-dien-1-ylidene-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfonic acid.
| Compound Name | 2-[cyclohexa-2,5-dien-1-ylidene-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 175844711 |
| Molecular Formula | C28H27NO7S2 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 2-[cyclohexa-2,5-dien-1-ylidene-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfonic acid |
| SMILES | CCN(Cc1cccc(S(=O)(=O)O)c1)c1ccc(C(=C2C=CCC=C2)c2ccc(O)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H27NO7S2/c1-2-29(19-20-7-6-10-25(17-20)37(31,32)33)23-13-11-22(12-14-23)28(21-8-4-3-5-9-21)26-16-15-24(30)18-27(26)38(34,35)36/h4-18,30H,2-3,19H2,1H3,(H,31,32,33)(H,34,35,36) |
| InChIKey | XXCHUQVKOXSTIM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|