C37H35N2O7S2- — CID 158608612
2-[[4-[ethyl-[(3-sulfonatophenyl)methyl]amino]phenyl]-[4-[methyl-[(3-methylphenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]methyl]-5-hydroxybenzenesulfonate (PubChem CID 158608612) has the molecular formula C37H35N2O7S2- and a molecular weight of 683.83 g/mol. Its IUPAC name is 2-[[4-[ethyl-[(3-sulfonatophenyl)methyl]amino]phenyl]-[4-[methyl-[(3-methylphenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]methyl]-5-hydroxybenzenesulfonate.
| Compound Name | 2-[[4-[ethyl-[(3-sulfonatophenyl)methyl]amino]phenyl]-[4-[methyl-[(3-methylphenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]methyl]-5-hydroxybenzenesulfonate |
|---|---|
| PubChem CID | 158608612 |
| Molecular Formula | C37H35N2O7S2- |
| Molecular Weight | 683.83 g/mol |
| Exact Mass | 683.19 |
| IUPAC Name | 2-[[4-[ethyl-[(3-sulfonatophenyl)methyl]amino]phenyl]-[4-[methyl-[(3-methylphenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]methyl]-5-hydroxybenzenesulfonate |
| SMILES | CCN(Cc1cccc(S(=O)(=O)[O-])c1)c1ccc(C(=C2C=CC(=[N+](C)Cc3cccc(C)c3)C=C2)c2ccc(O)cc2S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C37H36N2O7S2/c1-4-39(25-28-9-6-10-34(22-28)47(41,42)43)32-17-13-30(14-18-32)37(35-20-19-33(40)23-36(35)48(44,45)46)29-11-15-31(16-12-29)38(3)24-27-8-5-7-26(2)21-27/h5-23H,4,24-25H2,1-3H3,(H2,41,42,43,44,45,46)/p-1 |
| InChIKey | HWNYIWORSJWBTF-UHFFFAOYSA-M |
| XLogP | 5.75 |
| TPSA | 140.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.83 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|