C38H38N2O5S2 — CID 89089385
2-[[4-[ethyl-[(3-methylphenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-[ethyl-[(3-sulfinophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfinate (PubChem CID 89089385) has the molecular formula C38H38N2O5S2 and a molecular weight of 666.87 g/mol. Its IUPAC name is 2-[[4-[ethyl-[(3-methylphenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-[ethyl-[(3-sulfinophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfinate.
| Compound Name | 2-[[4-[ethyl-[(3-methylphenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-[ethyl-[(3-sulfinophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfinate |
|---|---|
| PubChem CID | 89089385 |
| Molecular Formula | C38H38N2O5S2 |
| Molecular Weight | 666.87 g/mol |
| Exact Mass | 666.22 |
| IUPAC Name | 2-[[4-[ethyl-[(3-methylphenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-[ethyl-[(3-sulfinophenyl)methyl]amino]phenyl]methyl]-5-hydroxybenzenesulfinate |
| SMILES | CCN(Cc1cccc(S(=O)O)c1)c1ccc(C(=C2C=CC(=[N+](CC)Cc3cccc(C)c3)C=C2)c2ccc(O)cc2S(=O)[O-])cc1 |
| InChI | InChI=1S/C38H38N2O5S2/c1-4-39(25-28-9-6-8-27(3)22-28)32-16-12-30(13-17-32)38(36-21-20-34(41)24-37(36)47(44)45)31-14-18-33(19-15-31)40(5-2)26-29-10-7-11-35(23-29)46(42)43/h6-24H,4-5,25-26H2,1-3H3,(H2,42,43,44,45) |
| InChIKey | RZALLHXNFBXEEY-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.87 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|