C15H17NO6S2 — CID 53425538
3-[(N-ethyl-3-sulfoanilino)methyl]benzenesulfonic acid (PubChem CID 53425538) has the molecular formula C15H17NO6S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[(N-ethyl-3-sulfoanilino)methyl]benzenesulfonic acid.
| Compound Name | 3-[(N-ethyl-3-sulfoanilino)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 53425538 |
| Molecular Formula | C15H17NO6S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 3-[(N-ethyl-3-sulfoanilino)methyl]benzenesulfonic acid |
| SMILES | CCN(Cc1cccc(S(=O)(=O)O)c1)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C15H17NO6S2/c1-2-16(13-6-4-8-15(10-13)24(20,21)22)11-12-5-3-7-14(9-12)23(17,18)19/h3-10H,2,11H2,1H3,(H,17,18,19)(H,20,21,22) |
| InChIKey | UXAHNCGFDXFNPH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|