C22H32N2O4S — CID 88812195
3-[[5-(diethylamino)-2-ethoxy-N-ethyl-3-methylanilino]methyl]benzenesulfonic acid (PubChem CID 88812195) has the molecular formula C22H32N2O4S and a molecular weight of 420.58 g/mol. Its IUPAC name is 3-[[5-(diethylamino)-2-ethoxy-N-ethyl-3-methylanilino]methyl]benzenesulfonic acid.
| Compound Name | 3-[[5-(diethylamino)-2-ethoxy-N-ethyl-3-methylanilino]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 88812195 |
| Molecular Formula | C22H32N2O4S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 3-[[5-(diethylamino)-2-ethoxy-N-ethyl-3-methylanilino]methyl]benzenesulfonic acid |
| SMILES | CCOc1c(C)cc(N(CC)CC)cc1N(CC)Cc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C22H32N2O4S/c1-6-23(7-2)19-13-17(5)22(28-9-4)21(15-19)24(8-3)16-18-11-10-12-20(14-18)29(25,26)27/h10-15H,6-9,16H2,1-5H3,(H,25,26,27) |
| InChIKey | LLFJJDWLQMBXPO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|