C15H16BrNO3S — CID 21418904
3-[(3-bromo-N-ethylanilino)methyl]benzenesulfonic acid (PubChem CID 21418904) has the molecular formula C15H16BrNO3S and a molecular weight of 370.27 g/mol. Its IUPAC name is 3-[(3-bromo-N-ethylanilino)methyl]benzenesulfonic acid.
| Compound Name | 3-[(3-bromo-N-ethylanilino)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 21418904 |
| Molecular Formula | C15H16BrNO3S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 3-[(3-bromo-N-ethylanilino)methyl]benzenesulfonic acid |
| SMILES | CCN(Cc1cccc(S(=O)(=O)O)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H16BrNO3S/c1-2-17(14-7-4-6-13(16)10-14)11-12-5-3-8-15(9-12)21(18,19)20/h3-10H,2,11H2,1H3,(H,18,19,20) |
| InChIKey | SYBWAAQTSSPUBL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|