C22H26N2O3S — CID 88811425
3-aminobenzenesulfonic acid;N-benzyl-N-ethyl-3-methylaniline (PubChem CID 88811425) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 3-aminobenzenesulfonic acid;N-benzyl-N-ethyl-3-methylaniline.
| Compound Name | 3-aminobenzenesulfonic acid;N-benzyl-N-ethyl-3-methylaniline |
|---|---|
| PubChem CID | 88811425 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 3-aminobenzenesulfonic acid;N-benzyl-N-ethyl-3-methylaniline |
| SMILES | CCN(Cc1ccccc1)c1cccc(C)c1.Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C16H19N.C6H7NO3S/c1-3-17(13-15-9-5-4-6-10-15)16-11-7-8-14(2)12-16;7-5-2-1-3-6(4-5)11(8,9)10/h4-12H,3,13H2,1-2H3;1-4H,7H2,(H,8,9,10) |
| InChIKey | SMHZBSZXMHCQPP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|