C19H23NO5S — CID 162715247
3-[2-[(N-ethyl-3-methylanilino)methyl]-5-sulfophenyl]propanoic acid (PubChem CID 162715247) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is 3-[2-[(N-ethyl-3-methylanilino)methyl]-5-sulfophenyl]propanoic acid.
| Compound Name | 3-[2-[(N-ethyl-3-methylanilino)methyl]-5-sulfophenyl]propanoic acid |
|---|---|
| PubChem CID | 162715247 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 3-[2-[(N-ethyl-3-methylanilino)methyl]-5-sulfophenyl]propanoic acid |
| SMILES | CCN(Cc1ccc(S(=O)(=O)O)cc1CCC(=O)O)c1cccc(C)c1 |
| InChI | InChI=1S/C19H23NO5S/c1-3-20(17-6-4-5-14(2)11-17)13-16-7-9-18(26(23,24)25)12-15(16)8-10-19(21)22/h4-7,9,11-12H,3,8,10,13H2,1-2H3,(H,21,22)(H,23,24,25) |
| InChIKey | LGSRJALQYRWSGR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|