C17H21NO4S — CID 21391324
4-[2-(N-ethyl-3-methylanilino)ethoxy]benzenesulfonic acid (PubChem CID 21391324) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-[2-(N-ethyl-3-methylanilino)ethoxy]benzenesulfonic acid.
| Compound Name | 4-[2-(N-ethyl-3-methylanilino)ethoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 21391324 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-[2-(N-ethyl-3-methylanilino)ethoxy]benzenesulfonic acid |
| SMILES | CCN(CCOc1ccc(S(=O)(=O)O)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C17H21NO4S/c1-3-18(15-6-4-5-14(2)13-15)11-12-22-16-7-9-17(10-8-16)23(19,20)21/h4-10,13H,3,11-12H2,1-2H3,(H,19,20,21) |
| InChIKey | RFQBKLJVXGBCDP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|