C14H19NO2 — CID 137371297
2-(N-ethyl-3-methylanilino)ethyl prop-2-enoate (PubChem CID 137371297) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-(N-ethyl-3-methylanilino)ethyl prop-2-enoate.
| Compound Name | 2-(N-ethyl-3-methylanilino)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 137371297 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-(N-ethyl-3-methylanilino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(CC)c1cccc(C)c1 |
| InChI | InChI=1S/C14H19NO2/c1-4-14(16)17-10-9-15(5-2)13-8-6-7-12(3)11-13/h4,6-8,11H,1,5,9-10H2,2-3H3 |
| InChIKey | MBGNVNWOZYXMEB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|