C18H33N2O+ — CID 153492918
diethyl-[2-[2-(N-ethyl-3-methylanilino)ethoxy]ethyl]-methylazanium (PubChem CID 153492918) has the molecular formula C18H33N2O+ and a molecular weight of 293.47 g/mol. Its IUPAC name is diethyl-[2-[2-(N-ethyl-3-methylanilino)ethoxy]ethyl]-methylazanium.
| Compound Name | diethyl-[2-[2-(N-ethyl-3-methylanilino)ethoxy]ethyl]-methylazanium |
|---|---|
| PubChem CID | 153492918 |
| Molecular Formula | C18H33N2O+ |
| Molecular Weight | 293.47 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | diethyl-[2-[2-(N-ethyl-3-methylanilino)ethoxy]ethyl]-methylazanium |
| SMILES | CCN(CCOCC[N+](C)(CC)CC)c1cccc(C)c1 |
| InChI | InChI=1S/C18H33N2O/c1-6-19(18-11-9-10-17(4)16-18)12-14-21-15-13-20(5,7-2)8-3/h9-11,16H,6-8,12-15H2,1-5H3/q+1 |
| InChIKey | PWMUPYBQTMMYND-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|