C24H45N2O4+ — CID 148560037
2-[2-[2-[2-[2-(N-ethyl-3-methylanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-dimethyl-propylazanium (PubChem CID 148560037) has the molecular formula C24H45N2O4+ and a molecular weight of 425.63 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(N-ethyl-3-methylanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-dimethyl-propylazanium.
| Compound Name | 2-[2-[2-[2-[2-(N-ethyl-3-methylanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-dimethyl-propylazanium |
|---|---|
| PubChem CID | 148560037 |
| Molecular Formula | C24H45N2O4+ |
| Molecular Weight | 425.63 g/mol |
| Exact Mass | 425.34 |
| IUPAC Name | 2-[2-[2-[2-[2-(N-ethyl-3-methylanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-dimethyl-propylazanium |
| SMILES | CCC[N+](C)(C)CCOCCOCCOCCOCCN(CC)c1cccc(C)c1 |
| InChI | InChI=1S/C24H45N2O4/c1-6-12-26(4,5)13-15-28-17-19-30-21-20-29-18-16-27-14-11-25(7-2)24-10-8-9-23(3)22-24/h8-10,22H,6-7,11-21H2,1-5H3/q+1 |
| InChIKey | PQSCDNBYEHCXJF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.63 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|