C20H37N2O+ — CID 70799761
triethyl-[2-[2-(N-ethyl-3,4-dimethylanilino)ethoxy]ethyl]azanium (PubChem CID 70799761) has the molecular formula C20H37N2O+ and a molecular weight of 321.53 g/mol. Its IUPAC name is triethyl-[2-[2-(N-ethyl-3,4-dimethylanilino)ethoxy]ethyl]azanium.
| Compound Name | triethyl-[2-[2-(N-ethyl-3,4-dimethylanilino)ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 70799761 |
| Molecular Formula | C20H37N2O+ |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 321.29 |
| IUPAC Name | triethyl-[2-[2-(N-ethyl-3,4-dimethylanilino)ethoxy]ethyl]azanium |
| SMILES | CCN(CCOCC[N+](CC)(CC)CC)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H37N2O/c1-7-21(20-12-11-18(5)19(6)17-20)13-15-23-16-14-22(8-2,9-3)10-4/h11-12,17H,7-10,13-16H2,1-6H3/q+1 |
| InChIKey | IWVHBQHCMJKRII-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|