C16H27IN2O3 — CID 88729570
4-N-ethyl-1-N-iodo-4-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-methylbenzene-1,4-diamine (PubChem CID 88729570) has the molecular formula C16H27IN2O3 and a molecular weight of 422.31 g/mol. Its IUPAC name is 4-N-ethyl-1-N-iodo-4-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-methylbenzene-1,4-diamine.
| Compound Name | 4-N-ethyl-1-N-iodo-4-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 88729570 |
| Molecular Formula | C16H27IN2O3 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 4-N-ethyl-1-N-iodo-4-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-methylbenzene-1,4-diamine |
| SMILES | CCN(CCOCCOCCOC)c1ccc(NI)c(C)c1 |
| InChI | InChI=1S/C16H27IN2O3/c1-4-19(7-8-21-11-12-22-10-9-20-3)15-5-6-16(18-17)14(2)13-15/h5-6,13,18H,4,7-12H2,1-3H3 |
| InChIKey | XEPBFMAJFJTCHN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|