C14H26N2OSi — CID 91723976
4-N-ethyl-2-methyl-4-N-(2-trimethylsilyloxyethyl)benzene-1,4-diamine (PubChem CID 91723976) has the molecular formula C14H26N2OSi and a molecular weight of 266.46 g/mol. Its IUPAC name is 4-N-ethyl-2-methyl-4-N-(2-trimethylsilyloxyethyl)benzene-1,4-diamine.
| Compound Name | 4-N-ethyl-2-methyl-4-N-(2-trimethylsilyloxyethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 91723976 |
| Molecular Formula | C14H26N2OSi |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 4-N-ethyl-2-methyl-4-N-(2-trimethylsilyloxyethyl)benzene-1,4-diamine |
| SMILES | CCN(CCO[Si](C)(C)C)c1ccc(N)c(C)c1 |
| InChI | InChI=1S/C14H26N2OSi/c1-6-16(9-10-17-18(3,4)5)13-7-8-14(15)12(2)11-13/h7-8,11H,6,9-10,15H2,1-5H3 |
| InChIKey | XYROAVVQRLBTIL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|