C32H67N3O3+2 — CID 158816775
2-[2-[2,5-dimethyl-N-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl-triethylazanium;methane (PubChem CID 158816775) has the molecular formula C32H67N3O3+2 and a molecular weight of 541.91 g/mol. Its IUPAC name is 2-[2-[2,5-dimethyl-N-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl-triethylazanium;methane.
| Compound Name | 2-[2-[2,5-dimethyl-N-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl-triethylazanium;methane |
|---|---|
| PubChem CID | 158816775 |
| Molecular Formula | C32H67N3O3+2 |
| Molecular Weight | 541.91 g/mol |
| Exact Mass | 541.52 |
| IUPAC Name | 2-[2-[2,5-dimethyl-N-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl-triethylazanium;methane |
| SMILES | C.C.CC[N+](CC)(CC)CCOCCOCCN(CCOCC[N+](CC)(CC)CC)c1cc(C)ccc1C |
| InChI | InChI=1S/C30H59N3O3.2CH4/c1-9-32(10-2,11-3)19-23-34-21-17-31(30-27-28(7)15-16-29(30)8)18-22-35-25-26-36-24-20-33(12-4,13-5)14-6;;/h15-16,27H,9-14,17-26H2,1-8H3;2*1H4/q+2;; |
| InChIKey | IVJGBOJKZITMDI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.91 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|