C13H21NO — CID 110935894
3-(N-ethyl-2,5-dimethylanilino)propan-1-ol (PubChem CID 110935894) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-(N-ethyl-2,5-dimethylanilino)propan-1-ol.
| Compound Name | 3-(N-ethyl-2,5-dimethylanilino)propan-1-ol |
|---|---|
| PubChem CID | 110935894 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3-(N-ethyl-2,5-dimethylanilino)propan-1-ol |
| SMILES | CCN(CCCO)c1cc(C)ccc1C |
| InChI | InChI=1S/C13H21NO/c1-4-14(8-5-9-15)13-10-11(2)6-7-12(13)3/h6-7,10,15H,4-5,8-9H2,1-3H3 |
| InChIKey | ZZNZMENXIRVXGT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |