C17H26N2O2 — CID 113124355
3-(N-acetyl-2,5-dimethylanilino)-N,N-diethylpropanamide (PubChem CID 113124355) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-(N-acetyl-2,5-dimethylanilino)-N,N-diethylpropanamide.
| Compound Name | 3-(N-acetyl-2,5-dimethylanilino)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 113124355 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-(N-acetyl-2,5-dimethylanilino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCN(C(C)=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C17H26N2O2/c1-6-18(7-2)17(21)10-11-19(15(5)20)16-12-13(3)8-9-14(16)4/h8-9,12H,6-7,10-11H2,1-5H3 |
| InChIKey | VPDZYWSRIRFPNW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |