C16H23BrN2O2 — CID 113128676
3-(N-acetyl-3-bromo-4-methylanilino)-N,N-diethylpropanamide (PubChem CID 113128676) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 3-(N-acetyl-3-bromo-4-methylanilino)-N,N-diethylpropanamide.
| Compound Name | 3-(N-acetyl-3-bromo-4-methylanilino)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 113128676 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 3-(N-acetyl-3-bromo-4-methylanilino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCN(C(C)=O)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C16H23BrN2O2/c1-5-18(6-2)16(21)9-10-19(13(4)20)14-8-7-12(3)15(17)11-14/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | DWAFFXKPNYRLGH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |