C11H14NO2- — CID 57353487
N-(2,5-dimethylphenyl)-N-ethylcarbamate (PubChem CID 57353487) has the molecular formula C11H14NO2- and a molecular weight of 192.24 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N-ethylcarbamate.
| Compound Name | N-(2,5-dimethylphenyl)-N-ethylcarbamate |
|---|---|
| PubChem CID | 57353487 |
| Molecular Formula | C11H14NO2- |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N-ethylcarbamate |
| SMILES | CCN(C(=O)[O-])c1cc(C)ccc1C |
| InChI | InChI=1S/C11H15NO2/c1-4-12(11(13)14)10-7-8(2)5-6-9(10)3/h5-7H,4H2,1-3H3,(H,13,14)/p-1 |
| InChIKey | YBNLWBYKVLVFOE-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |