C19H28N2O4-2 — CID 57360084
N-[3-[carboxylato(pentyl)amino]-4-methylphenyl]-N-pentylcarbamate (PubChem CID 57360084) has the molecular formula C19H28N2O4-2 and a molecular weight of 348.44 g/mol. Its IUPAC name is N-[3-[carboxylato(pentyl)amino]-4-methylphenyl]-N-pentylcarbamate.
| Compound Name | N-[3-[carboxylato(pentyl)amino]-4-methylphenyl]-N-pentylcarbamate |
|---|---|
| PubChem CID | 57360084 |
| Molecular Formula | C19H28N2O4-2 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | N-[3-[carboxylato(pentyl)amino]-4-methylphenyl]-N-pentylcarbamate |
| SMILES | CCCCCN(C(=O)[O-])c1ccc(C)c(N(CCCCC)C(=O)[O-])c1 |
| InChI | InChI=1S/C19H30N2O4/c1-4-6-8-12-20(18(22)23)16-11-10-15(3)17(14-16)21(19(24)25)13-9-7-5-2/h10-11,14H,4-9,12-13H2,1-3H3,(H,22,23)(H,24,25)/p-2 |
| InChIKey | RTARKERCGYWQSC-UHFFFAOYSA-L |
| XLogP | 2.67 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|