C25H36N2O3 — CID 129120364
1,3-bis[4-(hydroxymethyl)phenyl]-1,3-dipentylurea (PubChem CID 129120364) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 1,3-bis[4-(hydroxymethyl)phenyl]-1,3-dipentylurea.
| Compound Name | 1,3-bis[4-(hydroxymethyl)phenyl]-1,3-dipentylurea |
|---|---|
| PubChem CID | 129120364 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 1,3-bis[4-(hydroxymethyl)phenyl]-1,3-dipentylurea |
| SMILES | CCCCCN(C(=O)N(CCCCC)c1ccc(CO)cc1)c1ccc(CO)cc1 |
| InChI | InChI=1S/C25H36N2O3/c1-3-5-7-17-26(23-13-9-21(19-28)10-14-23)25(30)27(18-8-6-4-2)24-15-11-22(20-29)12-16-24/h9-16,28-29H,3-8,17-20H2,1-2H3 |
| InChIKey | OPVWUYDLKGCPBQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|