C15H23NO3 — CID 54572400
N-(3,4-dihydroxyphenyl)-N-hexylpropanamide (PubChem CID 54572400) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is N-(3,4-dihydroxyphenyl)-N-hexylpropanamide.
| Compound Name | N-(3,4-dihydroxyphenyl)-N-hexylpropanamide |
|---|---|
| PubChem CID | 54572400 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-(3,4-dihydroxyphenyl)-N-hexylpropanamide |
| SMILES | CCCCCCN(C(=O)CC)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H23NO3/c1-3-5-6-7-10-16(15(19)4-2)12-8-9-13(17)14(18)11-12/h8-9,11,17-18H,3-7,10H2,1-2H3 |
| InChIKey | ZYFWCEHGBMTDDU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|