C16H17NO3 — CID 67853659
N-benzyl-N-(3,4-dihydroxyphenyl)propanamide (PubChem CID 67853659) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-benzyl-N-(3,4-dihydroxyphenyl)propanamide.
| Compound Name | N-benzyl-N-(3,4-dihydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 67853659 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-benzyl-N-(3,4-dihydroxyphenyl)propanamide |
| SMILES | CCC(=O)N(Cc1ccccc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H17NO3/c1-2-16(20)17(11-12-6-4-3-5-7-12)13-8-9-14(18)15(19)10-13/h3-10,18-19H,2,11H2,1H3 |
| InChIKey | IEAZZBNKMSAFAT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|